CAS 35577-92-5 appears in our catalog under these names: 4–Phenyl–1H–indole, 4-Phenyl-1H-indole, 4-Phenyl-1H-indole, 95%, 95%, 4-PHENYL-1H-INDOLE, 98%. Offered by: GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 5g, 0,5g, 250mg, 1g.
4-phenyl-1H-indole (CAS 35577-92-5) is a chemical compound with the molecular formula C14H11N and a molecular weight of 193.24 g/mol. IUPAC name: 4-phenyl-1H-indole. InChIKey: LCTDIQQSJICLJM-UHFFFAOYSA-N.
| Molecular formula | C14H11N |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | 4-phenyl-1H-indole |
| InChIKey | LCTDIQQSJICLJM-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C3C=CNC3=CC=C2 |
Computed by PubChem (NCBI)