cas: 17688-68-5 — see every product listed under this CAS number, including other names
4-Phenylthiomorpholine 1,1-Dioxide, 98%, 98% (CAS 17688-68-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1135YB-1g |
| cas | 17688-68-5 |
| size | 1g |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 179.60 Pln | |
| Chemat | 5g | 357.20 Pln | |
| Chemat | 25g | 1178.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4-phenyl-1,4-thiazinane 1,1-dioxide (CAS 17688-68-5) is a chemical compound with the molecular formula C10H13NO2S and a molecular weight of 211.28 g/mol. IUPAC name: 4-phenyl-1,4-thiazinane 1,1-dioxide. InChIKey: OLQHDKQJHKZUNN-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2S |
|---|---|
| Molecular weight | 211.28 g/mol |
| IUPAC name | 4-phenyl-1,4-thiazinane 1,1-dioxide |
| InChIKey | OLQHDKQJHKZUNN-UHFFFAOYSA-N |
| SMILES | C1CS(=O)(=O)CCN1C2=CC=CC=C2 |
Computed by PubChem (NCBI)