cas: 113439-83-1 — see every product listed under this CAS number, including other names
4-Phthalimido-2-butyne, 95+%, 95+% (CAS 113439-83-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1119LF-100mg |
| cas | 113439-83-1 |
| size | 100mg |
| availability | 50g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 107.60 Pln | |
| Chemat | 250mg | 136.40 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 419.60 Pln | |
| Chemat | 25g | 1677.20 Pln |
| purity | 95+% |
|---|---|
| delivery time | 3 weeks |
2-but-2-ynylisoindole-1,3-dione (CAS 113439-83-1) is a chemical compound with the molecular formula C12H9NO2 and a molecular weight of 199.20 g/mol. IUPAC name: 2-but-2-ynylisoindole-1,3-dione. InChIKey: COPWPECHFWIYSP-UHFFFAOYSA-N.
| Molecular formula | C12H9NO2 |
|---|---|
| Molecular weight | 199.20 g/mol |
| IUPAC name | 2-but-2-ynylisoindole-1,3-dione |
| InChIKey | COPWPECHFWIYSP-UHFFFAOYSA-N |
| SMILES | CC#CCN1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)