cas: 81078-84-4 — see every product listed under this CAS number, including other names
4-Piperazin-1-yl-furo[3,2-c]pyridine, 95% (CAS 81078-84-4) is a chemical reagent available from Chemat. Available pack sizes: 250MG, 1g. Offered by: Thermo Scientific.
| brand | Thermo Scientific |
|---|---|
| catalog number | MO07255CB |
| cas | 81078-84-4 |
| size | 250MG |
| brand | size | price | |
|---|---|---|---|
| Thermo Scientific | 250MG | 529.44 Pln | |
| Thermo Scientific | 1g | 1318.52 Pln |
| delivery time | 2-3 weeks |
|---|---|
| category | Chemicals |
| purity | 95% |
4-piperazin-1-ylfuro[3,2-c]pyridine (CAS 81078-84-4) is a chemical compound with the molecular formula C11H13N3O and a molecular weight of 203.24 g/mol. IUPAC name: 4-piperazin-1-ylfuro[3,2-c]pyridine. InChIKey: LUIZVTKJWSGSPA-UHFFFAOYSA-N.
| Molecular formula | C11H13N3O |
|---|---|
| Molecular weight | 203.24 g/mol |
| IUPAC name | 4-piperazin-1-ylfuro[3,2-c]pyridine |
| InChIKey | LUIZVTKJWSGSPA-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C2=NC=CC3=C2C=CO3 |
Computed by PubChem (NCBI)