cas: 6306-24-7 — see every product listed under this CAS number, including other names
4-Sulfamoylbenzamide, 98% (CAS 6306-24-7) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A731664-10g |
| cas | 6306-24-7 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 4067.14 Pln | |
| AmBeed | 25g | 7686.70 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-sulfamoylbenzamide (CAS 6306-24-7) is a chemical compound with the molecular formula C7H8N2O3S and a molecular weight of 200.22 g/mol. IUPAC name: 4-sulfamoylbenzamide. InChIKey: MWFFIRCXGDGFQB-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3S |
|---|---|
| Molecular weight | 200.22 g/mol |
| IUPAC name | 4-sulfamoylbenzamide |
| InChIKey | MWFFIRCXGDGFQB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)N)S(=O)(=O)N |
Computed by PubChem (NCBI)