cas: 7236-57-9 — see every product listed under this CAS number, including other names
4-Thiothymidine, 98% (CAS 7236-57-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F555358-100MG |
| cas | 7236-57-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 857.01 Pln | |
| Fluorochem | 1g | 2221.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one (CAS 7236-57-9) is a chemical compound with the molecular formula C10H14N2O4S and a molecular weight of 258.30 g/mol. IUPAC name: 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one. InChIKey: AVKSPBJBGGHUMW-XLPZGREQSA-N.
| Molecular formula | C10H14N2O4S |
|---|---|
| Molecular weight | 258.30 g/mol |
| IUPAC name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-methyl-4-sulfanylidenepyrimidin-2-one |
| InChIKey | AVKSPBJBGGHUMW-XLPZGREQSA-N |
| SMILES | CC1=CN(C(=O)NC1=S)[C@H]2C[C@@H]([C@H](O2)CO)O |
Computed by PubChem (NCBI)