cas: 102422-55-9 — see every product listed under this CAS number, including other names
4-Trifluoromethylbenzylisocyanate 95% (CAS 102422-55-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A139480-1g |
| cas | 102422-55-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 209.06 Pln | |
| Ambeed | 25g | 553.94 Pln | |
| Ambeed | 100g | 1599.69 Pln | |
| Ambeed | 10g | 309.19 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A139480 |
1-(isocyanatomethyl)-4-(trifluoromethyl)benzene (CAS 102422-55-9) is a chemical compound with the molecular formula C9H6F3NO and a molecular weight of 201.14 g/mol. IUPAC name: 1-(isocyanatomethyl)-4-(trifluoromethyl)benzene. InChIKey: MBBQXHDBRSSIKS-UHFFFAOYSA-N.
| Molecular formula | C9H6F3NO |
|---|---|
| Molecular weight | 201.14 g/mol |
| IUPAC name | 1-(isocyanatomethyl)-4-(trifluoromethyl)benzene |
| InChIKey | MBBQXHDBRSSIKS-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CN=C=O)C(F)(F)F |
Computed by PubChem (NCBI)