cas: 1070879-60-5 — see every product listed under this CAS number, including other names
4-bromo-2,6,8-trimethylquinoline, 97%, 97% (CAS 1070879-60-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch118TFO-100mg |
| cas | 1070879-60-5 |
| size | 100mg |
| availability | 10g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 597.20 Pln | |
| Chemat | 1g | 1763.60 Pln | |
| Chemat | 5g | 6534.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-bromo-2,6,8-trimethylquinoline (CAS 1070879-60-5) is a chemical compound with the molecular formula C12H12BrN and a molecular weight of 250.13 g/mol. IUPAC name: 4-bromo-2,6,8-trimethylquinoline. InChIKey: ZLLFZRRHKAPRNV-UHFFFAOYSA-N.
| Molecular formula | C12H12BrN |
|---|---|
| Molecular weight | 250.13 g/mol |
| IUPAC name | 4-bromo-2,6,8-trimethylquinoline |
| InChIKey | ZLLFZRRHKAPRNV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C2C(=C1)C(=CC(=N2)C)Br)C |
Computed by PubChem (NCBI)