CAS 90057-08-2 appears in our catalog under these names: 6–Chloro–2–methoxy–7–deazapurine, 6-Chloro-2-methoxy-7-deazapurine, >95% (HPLC), 4-Chloro-2-methoxy-7H-pyrrolo(2,3-d)pyrimidine, 95%, 4-Chloro-2-methoxy-7H-pyrrolo[2,3-d]pyrimidine, ≥95%, ≥95%, 4-chloro-2-methoxy-7H-pyrrolo[2,3-d]pyrimidine, ≥95%. Offered by: GLPBio, TRC, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 50mg, 2,5g.
4-chloro-2-methoxy-7H-pyrrolo[2,3-d]pyrimidine (CAS 90057-08-2) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: 4-chloro-2-methoxy-7H-pyrrolo[2,3-d]pyrimidine. InChIKey: SWQQJGKVGZQZDT-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 4-chloro-2-methoxy-7H-pyrrolo[2,3-d]pyrimidine |
| InChIKey | SWQQJGKVGZQZDT-UHFFFAOYSA-N |
| SMILES | COC1=NC2=C(C=CN2)C(=N1)Cl |
Computed by PubChem (NCBI)