CAS 1184916-24-2 appears in our catalog under these names: 6-Chloroimidazo[1,2-b]pyridazine-2-methanol, 97%, 6-Chloroimidazo(1,2-b)pyridazinemethanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 10g.
(6-chloroimidazo[1,2-b]pyridazin-2-yl)methanol (CAS 1184916-24-2) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: (6-chloroimidazo[1,2-b]pyridazin-2-yl)methanol. InChIKey: NNACWOFKWGHMIQ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (6-chloroimidazo[1,2-b]pyridazin-2-yl)methanol |
| InChIKey | NNACWOFKWGHMIQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=NN2C1=NC(=C2)CO)Cl |
Computed by PubChem (NCBI)