Products 89660-20-8
CAS 89660-20-8 appears in our catalog under these names: 5-Chloro-3-methyl-1h-imidazo[4,5-b]pyridin-2(3h)-one, 98%, 5-Chloro-3-methyl-1H-imidazo(4,5-b)pyridin-2(3H)-one, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 25g, 5g, 10g.
5-chloro-3-methyl-1H-imidazo[4,5-b]pyridin-2-one (CAS 89660-20-8) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: 5-chloro-3-methyl-1H-imidazo[4,5-b]pyridin-2-one. InChIKey: UZWLAZJZNOJQAJ-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 5-chloro-3-methyl-1H-imidazo[4,5-b]pyridin-2-one |
| InChIKey | UZWLAZJZNOJQAJ-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC(=N2)Cl)NC1=O |
Computed by PubChem (NCBI)