CAS 1023758-00-0 is the registry number for 4-Chloro-3,6-dimethylisoxazolo[5,4-d]pyrimidine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-chloro-3,6-dimethyl-[1,2]oxazolo[5,4-d]pyrimidine (CAS 1023758-00-0) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: 4-chloro-3,6-dimethyl-[1,2]oxazolo[5,4-d]pyrimidine. InChIKey: CUFAYYSEUAURDV-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | 4-chloro-3,6-dimethyl-[1,2]oxazolo[5,4-d]pyrimidine |
| InChIKey | CUFAYYSEUAURDV-UHFFFAOYSA-N |
| SMILES | CC1=NOC2=C1C(=NC(=N2)C)Cl |
Computed by PubChem (NCBI)