CAS 912773-31-0 appears in our catalog under these names: 6-Chloro-2-hydrazino-1,3-benzoxazole, 95%, Benzoxazole, 6-chloro-2-hydrazinyl-, 95%, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 10g, 100g, 25g, 250mg, 100mg.
(6-chloro-1,3-benzoxazol-2-yl)hydrazine (CAS 912773-31-0) is a chemical compound with the molecular formula C7H6ClN3O and a molecular weight of 183.59 g/mol. IUPAC name: (6-chloro-1,3-benzoxazol-2-yl)hydrazine. InChIKey: MFBZXNCPIAFRAT-UHFFFAOYSA-N.
| Molecular formula | C7H6ClN3O |
|---|---|
| Molecular weight | 183.59 g/mol |
| IUPAC name | (6-chloro-1,3-benzoxazol-2-yl)hydrazine |
| InChIKey | MFBZXNCPIAFRAT-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1Cl)OC(=N2)NN |
Computed by PubChem (NCBI)