cas: 1016756-58-3 — see every product listed under this CAS number, including other names
4-ethoxy-3-fluorobenzenesulfonyl chloride, 97% (CAS 1016756-58-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F496227-100MG |
| cas | 1016756-58-3 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 487.35 Pln | |
| Fluorochem | 250mg | 669.57 Pln | |
| Fluorochem | 500mg | 1263.11 Pln | |
| Fluorochem | 1g | 1580.71 Pln | |
| Fluorochem | 2.5g | 3163.49 Pln | |
| Fluorochem | 5g | 4397.43 Pln | |
| Fluorochem | 10g | 6896.55 Pln | |
| Fluorochem | 25g | 13774.33 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
4-ethoxy-3-fluorobenzenesulfonyl chloride (CAS 1016756-58-3) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 4-ethoxy-3-fluorobenzenesulfonyl chloride. InChIKey: LYBSIGBOIHWSAN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO3S |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 4-ethoxy-3-fluorobenzenesulfonyl chloride |
| InChIKey | LYBSIGBOIHWSAN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)