Products 1461705-63-4

CAS 1461705-63-4 appears in our catalog under these names: 3-Fluoro-4-methoxy-2-methylbenzene-1-sulfonyl chloride, 95%, 3-Fluoro-4-methoxy-2-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.

3-fluoro-4-methoxy-2-methylbenzenesulfonyl chloride (CAS 1461705-63-4) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 3-fluoro-4-methoxy-2-methylbenzenesulfonyl chloride. InChIKey: BELVUVMOPNDPCJ-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO3S
Molecular weight238.66 g/mol
IUPAC name3-fluoro-4-methoxy-2-methylbenzenesulfonyl chloride
InChIKeyBELVUVMOPNDPCJ-UHFFFAOYSA-N
SMILESCC1=C(C=CC(=C1F)OC)S(=O)(=O)Cl

Computed by PubChem (NCBI)