CAS 1461705-63-4 appears in our catalog under these names: 3-Fluoro-4-methoxy-2-methylbenzene-1-sulfonyl chloride, 95%, 3-Fluoro-4-methoxy-2-methylbenzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 2,5g, 250mg.
3-fluoro-4-methoxy-2-methylbenzenesulfonyl chloride (CAS 1461705-63-4) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 3-fluoro-4-methoxy-2-methylbenzenesulfonyl chloride. InChIKey: BELVUVMOPNDPCJ-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO3S |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 3-fluoro-4-methoxy-2-methylbenzenesulfonyl chloride |
| InChIKey | BELVUVMOPNDPCJ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1F)OC)S(=O)(=O)Cl |
Computed by PubChem (NCBI)