CAS 264624-26-2 appears in our catalog under these names: 4-(2-Fluoroethoxy)benzene-1-sulfonyl chloride, 4-(2-Fluoroethoxy)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.
4-(2-fluoroethoxy)benzenesulfonyl chloride (CAS 264624-26-2) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 4-(2-fluoroethoxy)benzenesulfonyl chloride. InChIKey: PZGIOGPIPGPCBY-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO3S |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 4-(2-fluoroethoxy)benzenesulfonyl chloride |
| InChIKey | PZGIOGPIPGPCBY-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1OCCF)S(=O)(=O)Cl |
Computed by PubChem (NCBI)