Products 264624-26-2

CAS 264624-26-2 appears in our catalog under these names: 4-(2-Fluoroethoxy)benzene-1-sulfonyl chloride, 4-(2-Fluoroethoxy)benzene-1-sulfonyl chloride, 95%. Offered by: Biosynth, AmBeed. Available pack sizes: 1g, 100mg, 5g.

4-(2-fluoroethoxy)benzenesulfonyl chloride (CAS 264624-26-2) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 4-(2-fluoroethoxy)benzenesulfonyl chloride. InChIKey: PZGIOGPIPGPCBY-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO3S
Molecular weight238.66 g/mol
IUPAC name4-(2-fluoroethoxy)benzenesulfonyl chloride
InChIKeyPZGIOGPIPGPCBY-UHFFFAOYSA-N
SMILESC1=CC(=CC=C1OCCF)S(=O)(=O)Cl

Computed by PubChem (NCBI)