Products 1016756-58-3

CAS 1016756-58-3 appears in our catalog under these names: 4-ethoxy-3-fluorobenzenesulfonyl chloride, 97%, 4-Ethoxy-3-fluorobenzene-1-sulfonyl chloride, 4-Ethoxy-3-fluorobenzene-1-sulfonyl chloride, 97%, 4-Ethoxy-3-fluorobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Fluorochem, Biosynth, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g.

4-ethoxy-3-fluorobenzenesulfonyl chloride (CAS 1016756-58-3) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 4-ethoxy-3-fluorobenzenesulfonyl chloride. InChIKey: LYBSIGBOIHWSAN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO3S
Molecular weight238.66 g/mol
IUPAC name4-ethoxy-3-fluorobenzenesulfonyl chloride
InChIKeyLYBSIGBOIHWSAN-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)S(=O)(=O)Cl)F

Computed by PubChem (NCBI)