CAS 1016756-58-3 appears in our catalog under these names: 4-ethoxy-3-fluorobenzenesulfonyl chloride, 97%, 4-Ethoxy-3-fluorobenzene-1-sulfonyl chloride, 4-Ethoxy-3-fluorobenzene-1-sulfonyl chloride, 97%, 4-Ethoxy-3-fluorobenzene-1-sulfonyl chloride, 97%, 97%. Offered by: Fluorochem, Biosynth, AmBeed, Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g, 10g, 25g.
4-ethoxy-3-fluorobenzenesulfonyl chloride (CAS 1016756-58-3) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 4-ethoxy-3-fluorobenzenesulfonyl chloride. InChIKey: LYBSIGBOIHWSAN-UHFFFAOYSA-N.
| Molecular formula | C8H8ClFO3S |
|---|---|
| Molecular weight | 238.66 g/mol |
| IUPAC name | 4-ethoxy-3-fluorobenzenesulfonyl chloride |
| InChIKey | LYBSIGBOIHWSAN-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)S(=O)(=O)Cl)F |
Computed by PubChem (NCBI)