Products 67475-57-4

CAS 67475-57-4 appears in our catalog under these names: 2-ethoxy-5-fluorobenzene-1-sulfonyl chloride, 95%, 95%, 2-Ethoxy-5-fluorobenzene-1-sulfonyl chloride, 95%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2-ethoxy-5-fluorobenzenesulfonyl chloride (CAS 67475-57-4) is a chemical compound with the molecular formula C8H8ClFO3S and a molecular weight of 238.66 g/mol. IUPAC name: 2-ethoxy-5-fluorobenzenesulfonyl chloride. InChIKey: XCPZPUYEHPEEEN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8ClFO3S
Molecular weight238.66 g/mol
IUPAC name2-ethoxy-5-fluorobenzenesulfonyl chloride
InChIKeyXCPZPUYEHPEEEN-UHFFFAOYSA-N
SMILESCCOC1=C(C=C(C=C1)F)S(=O)(=O)Cl

Computed by PubChem (NCBI)