cas: 6299-39-4 — see every product listed under this CAS number, including other names
4-nitro-1H-1,2,3-benzotriazole, 97% (CAS 6299-39-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F818528-100MG |
| cas | 6299-39-4 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 112.48 Pln | |
| Fluorochem | 250mg | 148.92 Pln | |
| Fluorochem | 1g | 232.23 Pln | |
| Fluorochem | 5g | 872.63 Pln | |
| Fluorochem | 1g | 169.75 Pln | |
| Fluorochem | 5g | 586.27 Pln | |
| Fluorochem | 10g | 1101.71 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 5g | 659.62 Pln |
| purity | 97% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
4-nitro-2H-benzotriazole (CAS 6299-39-4) is a chemical compound with the molecular formula C6H4N4O2 and a molecular weight of 164.12 g/mol. IUPAC name: 4-nitro-2H-benzotriazole. InChIKey: UTMDJGPRCLQPBT-UHFFFAOYSA-N.
| Molecular formula | C6H4N4O2 |
|---|---|
| Molecular weight | 164.12 g/mol |
| IUPAC name | 4-nitro-2H-benzotriazole |
| InChIKey | UTMDJGPRCLQPBT-UHFFFAOYSA-N |
| SMILES | C1=CC2=NNN=C2C(=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)