CAS 70978-54-0 appears in our catalog under these names: 5'-Bromo-2'-hydroxy-3'-nitroacetophenone, 98%, 5'-Bromo-2'-hydroxy-3'-nitroacetophenone, 97% , 5'-Bromo-2'-hydroxy-3'-nitroacetophenone, >98.0%(GC)(T), 1-(5-Bromo-2-hydroxy-3-nitrophenyl)ethanone 98%, 5'-BROMO-2'-HYDROXY-3'-NITROACETOPHENON&. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 5g, 1g, 25g, 10g, 100g.
1-(5-bromo-2-hydroxy-3-nitrophenyl)ethanone (CAS 70978-54-0) is a chemical compound with the molecular formula C8H6BrNO4 and a molecular weight of 260.04 g/mol. IUPAC name: 1-(5-bromo-2-hydroxy-3-nitrophenyl)ethanone. InChIKey: CLNIBJASCGZXHH-UHFFFAOYSA-N.
| Molecular formula | C8H6BrNO4 |
|---|---|
| Molecular weight | 260.04 g/mol |
| IUPAC name | 1-(5-bromo-2-hydroxy-3-nitrophenyl)ethanone |
| InChIKey | CLNIBJASCGZXHH-UHFFFAOYSA-N |
| SMILES | CC(=O)C1=C(C(=CC(=C1)Br)[N+](=O)[O-])O |
Computed by PubChem (NCBI)