cas: 2057507-59-0 — see every product listed under this CAS number, including other names
5,5-DIMETHYL-3-(4,4,5,5-TETRAMETHYL-1,3,2-DIOXABOROLAN-2-YL)-5,6-DIHYDRO-4H-PYRROLO[1,2-B]PYRAZOLE, 95% (CAS 2057507-59-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg. Offered by: Fluorochem, Ambeed, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F539030-100MG |
| cas | 2057507-59-0 |
| size | 100mg |
| availability | In Stock China |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1263.11 Pln | |
| Fluorochem | 250mg | 2403.34 Pln | |
| Fluorochem | 1g | 6808.04 Pln | |
| Fluorochem | 5g | 22156.80 Pln | |
| Ambeed | 50mg | 759.75 Pln | |
| BLDpharm | 50mg | 830.84 Pln | |
| BLDpharm | 100mg | 1141.84 Pln | |
| BLDpharm | 250mg | 2191.48 Pln | |
| BLDpharm | 1g | 6367.78 Pln | |
| BLDpharm | 5g | 22117.79 Pln |
| purity | 95,00% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,6-dihydropyrrolo[2,1-e]pyrazole (CAS 2057507-59-0) is a chemical compound with the molecular formula C14H23BN2O2 and a molecular weight of 262.16 g/mol. IUPAC name: 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,6-dihydropyrrolo[2,1-e]pyrazole. InChIKey: JJAODUJOYOMWDG-UHFFFAOYSA-N.
| Molecular formula | C14H23BN2O2 |
|---|---|
| Molecular weight | 262.16 g/mol |
| IUPAC name | 5,5-dimethyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4,6-dihydropyrrolo[2,1-e]pyrazole |
| InChIKey | JJAODUJOYOMWDG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C3CC(CN3N=C2)(C)C |
Computed by PubChem (NCBI)