cas: 4994-88-1 — see every product listed under this CAS number, including other names
5,6,7,8-Tetrahydro-benzo[4,5]thieno[2,3-d]pyrimidin-4-ylamine, 95%, 95% (CAS 4994-88-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DIF5-100mg |
| cas | 4994-88-1 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 405.20 Pln | |
| Chemat | 250mg | 578.00 Pln | |
| Chemat | 1g | 1096.40 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine (CAS 4994-88-1) is a chemical compound with the molecular formula C10H11N3S and a molecular weight of 205.28 g/mol. IUPAC name: 5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine. InChIKey: QXPQVUQBEBHHQP-UHFFFAOYSA-N.
| Molecular formula | C10H11N3S |
|---|---|
| Molecular weight | 205.28 g/mol |
| IUPAC name | 5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-amine |
| InChIKey | QXPQVUQBEBHHQP-UHFFFAOYSA-N |
| SMILES | C1CCC2=C(C1)C3=C(N=CN=C3S2)N |
Computed by PubChem (NCBI)