cas: 3237-62-5 — see every product listed under this CAS number, including other names
5,6-Dichloro-1-ethyl-2-methyl-1H-benzo[d]imidazole, 98% (CAS 3237-62-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F242430-1G |
| cas | 3237-62-5 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 190.58 Pln | |
| Fluorochem | 2.5g | 258.26 Pln | |
| Fluorochem | 5g | 325.94 Pln | |
| Fluorochem | 25g | 1419.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,6-dichloro-1-ethyl-2-methylbenzimidazole (CAS 3237-62-5) is a chemical compound with the molecular formula C10H10Cl2N2 and a molecular weight of 229.10 g/mol. IUPAC name: 5,6-dichloro-1-ethyl-2-methylbenzimidazole. InChIKey: IVVLMQPTQOLYDX-UHFFFAOYSA-N.
| Molecular formula | C10H10Cl2N2 |
|---|---|
| Molecular weight | 229.10 g/mol |
| IUPAC name | 5,6-dichloro-1-ethyl-2-methylbenzimidazole |
| InChIKey | IVVLMQPTQOLYDX-UHFFFAOYSA-N |
| SMILES | CCN1C(=NC2=CC(=C(C=C21)Cl)Cl)C |
Computed by PubChem (NCBI)