CAS 93296-41-4 appears in our catalog under these names: 5,6-Dichloro-1H-indene-1,3(2H)-dione, 98%, 98%, 5,6-DICHLORO-1H-INDENE-1,3(2H)-DIONE, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
5,6-dichloroindene-1,3-dione (CAS 93296-41-4) is a chemical compound with the molecular formula C9H4Cl2O2 and a molecular weight of 215.03 g/mol. IUPAC name: 5,6-dichloroindene-1,3-dione. InChIKey: DMJDPMXHMLDKKK-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2 |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 5,6-dichloroindene-1,3-dione |
| InChIKey | DMJDPMXHMLDKKK-UHFFFAOYSA-N |
| SMILES | C1C(=O)C2=CC(=C(C=C2C1=O)Cl)Cl |
Computed by PubChem (NCBI)