CAS 57645-97-3 appears in our catalog under these names: 6,8-Dichloro-4H-chromen-4-one, 97%, 6,8-Dichlorochromone, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg.
6,8-dichlorochromen-4-one (CAS 57645-97-3) is a chemical compound with the molecular formula C9H4Cl2O2 and a molecular weight of 215.03 g/mol. IUPAC name: 6,8-dichlorochromen-4-one. InChIKey: WCIMKEGMFYKKSQ-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2 |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 6,8-dichlorochromen-4-one |
| InChIKey | WCIMKEGMFYKKSQ-UHFFFAOYSA-N |
| SMILES | C1=COC2=C(C1=O)C=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)