CAS 20300-61-2 is the registry number for 6,8-Dichloro-2H-chromen-2-one, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
6,8-dichlorochromen-2-one (CAS 20300-61-2) is a chemical compound with the molecular formula C9H4Cl2O2 and a molecular weight of 215.03 g/mol. IUPAC name: 6,8-dichlorochromen-2-one. InChIKey: VXNXVBSMMLEIIB-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2 |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 6,8-dichlorochromen-2-one |
| InChIKey | VXNXVBSMMLEIIB-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=C(C=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)