CAS 213670-28-1 is the registry number for 6,7-Dichloro-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-dichlorochromen-2-one (CAS 213670-28-1) is a chemical compound with the molecular formula C9H4Cl2O2 and a molecular weight of 215.03 g/mol. IUPAC name: 6,7-dichlorochromen-2-one. InChIKey: XRIXFPBYSNLJQD-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2 |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 6,7-dichlorochromen-2-one |
| InChIKey | XRIXFPBYSNLJQD-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)OC2=CC(=C(C=C21)Cl)Cl |
Computed by PubChem (NCBI)