CAS 51069-80-8 is the registry number for 4,8-Dichloro-2H-chromen-2-one, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4,8-dichlorochromen-2-one (CAS 51069-80-8) is a chemical compound with the molecular formula C9H4Cl2O2 and a molecular weight of 215.03 g/mol. IUPAC name: 4,8-dichlorochromen-2-one. InChIKey: VJLQCLCAIFNHSC-UHFFFAOYSA-N.
| Molecular formula | C9H4Cl2O2 |
|---|---|
| Molecular weight | 215.03 g/mol |
| IUPAC name | 4,8-dichlorochromen-2-one |
| InChIKey | VJLQCLCAIFNHSC-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)Cl)OC(=O)C=C2Cl |
Computed by PubChem (NCBI)