5,6-Dichloropyridine-3-sulfonyl chloride, 98%
cas: 98121-40-5 — see every product listed under this CAS number, including other names
5,6-Dichloropyridine-3-sulfonyl chloride, 98% (CAS 98121-40-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, Chemat, BLDpharm.
| brand | Fluorochem |
|---|---|
| catalog number | F232202-100MG |
| cas | 98121-40-5 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 456.11 Pln | |
| Fluorochem | 250mg | 695.61 Pln | |
| Fluorochem | 1g | 1726.49 Pln | |
| Ambeed | 250mg | 704.12 Pln | |
| Ambeed | 1g | 1761.00 Pln | |
| Ambeed | 5g | 6366.75 Pln | |
| Chemat | 100mg | 501.20 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1874.00 Pln | |
| BLDpharm | 100mg | 497.63 Pln | |
| BLDpharm | 250mg | 753.09 Pln | |
| BLDpharm | 1g | 1897.13 Pln | |
| BLDpharm | 5g | 6862.05 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
5,6-dichloropyridine-3-sulfonyl chloride (CAS 98121-40-5) is a chemical compound with the molecular formula C5H2Cl3NO2S and a molecular weight of 246.5 g/mol. IUPAC name: 5,6-dichloropyridine-3-sulfonyl chloride. InChIKey: AXIWIKRWIWIPGT-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl3NO2S |
|---|---|
| Molecular weight | 246.5 g/mol |
| IUPAC name | 5,6-dichloropyridine-3-sulfonyl chloride |
| InChIKey | AXIWIKRWIWIPGT-UHFFFAOYSA-N |
| SMILES | C1=C(C=NC(=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)
Synonyms:
5,6-dichloropyridine-3-sulfonyl Chloride, 3-Pyridinesulfonyl chloride, 5,6-dichloro-, AXIWIKRWIWIPGT-UHFFFAOYSA-N, 5,6-dichloro-3-Pyridinesulfonyl chloride, 5-(Chlorosulphonyl)-2,3-dichloropyridine, 5,6-Dichloropyridine-3-sulphonyl chloride, (5,6-dichloro(3-pyridyl))chlorosulfone, 5,6-dichloropyridine-3-sulfonylchloride, 5,6-dichloropyridin-3-sulfonyl chloride, 2,3-dichloropyridine-5-sulfonyl chloride