CAS 1175278-16-6 appears in our catalog under these names: 4,5-Difluorobenzo(d)thiazol-2-amine, 95+%, 4,5-Difluoro-1,3-benzothiazol-2-amine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 100mg, 1g.
4,5-difluoro-1,3-benzothiazol-2-amine (CAS 1175278-16-6) is a chemical compound with the molecular formula C7H4F2N2S and a molecular weight of 186.18 g/mol. IUPAC name: 4,5-difluoro-1,3-benzothiazol-2-amine. InChIKey: SNFPJGYGBQVSDJ-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2S |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 4,5-difluoro-1,3-benzothiazol-2-amine |
| InChIKey | SNFPJGYGBQVSDJ-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1F)F)N=C(S2)N |
Computed by PubChem (NCBI)