CAS 1427397-93-0 is the registry number for 6,7-Difluorobenzo[d]thiazol-2-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
6,7-difluoro-1,3-benzothiazol-2-amine (CAS 1427397-93-0) is a chemical compound with the molecular formula C7H4F2N2S and a molecular weight of 186.18 g/mol. IUPAC name: 6,7-difluoro-1,3-benzothiazol-2-amine. InChIKey: MLEMJCZUOCOPFK-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2S |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 6,7-difluoro-1,3-benzothiazol-2-amine |
| InChIKey | MLEMJCZUOCOPFK-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C2=C1N=C(S2)N)F)F |
Computed by PubChem (NCBI)