CAS 119256-40-5 appears in our catalog under these names: 2–Amino–4,6–difluorobenzothiazole, 4,6-Difluorobenzothiazol-2-ylamine 98%, 4,6-Difluorobenzothiazol-2-ylamine, 98%, 98%, 2-Amino-4,6-difluorobenzothiazole, 95%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 100g, 10g.
4,6-difluoro-1,3-benzothiazol-2-amine (CAS 119256-40-5) is a chemical compound with the molecular formula C7H4F2N2S and a molecular weight of 186.18 g/mol. IUPAC name: 4,6-difluoro-1,3-benzothiazol-2-amine. InChIKey: DDKKXSCVPKDRRS-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2S |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 4,6-difluoro-1,3-benzothiazol-2-amine |
| InChIKey | DDKKXSCVPKDRRS-UHFFFAOYSA-N |
| SMILES | C1=C(C=C2C(=C1F)N=C(S2)N)F |
Computed by PubChem (NCBI)