CAS 788124-34-5 appears in our catalog under these names: 5,7-Difluorobenzo[d]thiazol-2-amine 97%, 2-Benzothiazolamine, 5,7-difluoro-, 97%, 97%, 2-Amino-5,7-difluorobenzothiazole, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
5,7-difluoro-1,3-benzothiazol-2-amine (CAS 788124-34-5) is a chemical compound with the molecular formula C7H4F2N2S and a molecular weight of 186.18 g/mol. IUPAC name: 5,7-difluoro-1,3-benzothiazol-2-amine. InChIKey: OEEBJKDZPLDBQI-UHFFFAOYSA-N.
| Molecular formula | C7H4F2N2S |
|---|---|
| Molecular weight | 186.18 g/mol |
| IUPAC name | 5,7-difluoro-1,3-benzothiazol-2-amine |
| InChIKey | OEEBJKDZPLDBQI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1N=C(S2)N)F)F |
Computed by PubChem (NCBI)