cas: 153894-33-8 — see every product listed under this CAS number, including other names
5,6-Dihydro-4H-benzo[b]thieno[2,3-d]azepine-2-carboxylic acid, 97% (CAS 153894-33-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F215573-100MG |
| cas | 153894-33-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 1903.51 Pln | |
| Fluorochem | 250mg | 2814.65 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
5,6-dihydro-4H-thieno[3,2-d][1]benzazepine-2-carboxylic acid (CAS 153894-33-8) is a chemical compound with the molecular formula C13H11NO2S and a molecular weight of 245.30 g/mol. IUPAC name: 5,6-dihydro-4H-thieno[3,2-d][1]benzazepine-2-carboxylic acid. InChIKey: SNJYGABQLZJUSJ-UHFFFAOYSA-N.
| Molecular formula | C13H11NO2S |
|---|---|
| Molecular weight | 245.30 g/mol |
| IUPAC name | 5,6-dihydro-4H-thieno[3,2-d][1]benzazepine-2-carboxylic acid |
| InChIKey | SNJYGABQLZJUSJ-UHFFFAOYSA-N |
| SMILES | C1CNC2=CC=CC=C2C3=C1C=C(S3)C(=O)O |
Computed by PubChem (NCBI)