cas: 62663-26-7 — see every product listed under this CAS number, including other names
5,6-Dimethoxy-2-phenyl-1H-indole 95% (CAS 62663-26-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A988316-100mg |
| cas | 62663-26-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 542.81 Pln | |
| Ambeed | 1g | 1171.38 Pln | |
| Ambeed | 5g | 3396.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A988316 |
5,6-dimethoxy-2-phenyl-1H-indole (CAS 62663-26-7) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: 5,6-dimethoxy-2-phenyl-1H-indole. InChIKey: VXTHRFKFXIWSTO-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 5,6-dimethoxy-2-phenyl-1H-indole |
| InChIKey | VXTHRFKFXIWSTO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C(=C1)C=C(N2)C3=CC=CC=C3)OC |
Computed by PubChem (NCBI)