CAS 18073-15-9 is the registry number for 6-Methoxy-1,4-dimethyl-9h-carbazole-3-carbaldehyde, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g, 250mg.
6-methoxy-1,4-dimethyl-9H-carbazole-3-carbaldehyde (CAS 18073-15-9) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: 6-methoxy-1,4-dimethyl-9H-carbazole-3-carbaldehyde. InChIKey: CPXAGPKGSHRHIO-UHFFFAOYSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | 6-methoxy-1,4-dimethyl-9H-carbazole-3-carbaldehyde |
| InChIKey | CPXAGPKGSHRHIO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C2=C1NC3=C2C=C(C=C3)OC)C)C=O |
Computed by PubChem (NCBI)