cas: 141211-39-4 — see every product listed under this CAS number, including other names
5,6-Dimethyl-1-(4-methylbenzyl)-1H-benzo(d)imidazole, 95% (CAS 141211-39-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1108050-5g |
| cas | 141211-39-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 7686.70 Pln | |
| AmBeed | 10g | 11495.05 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,6-dimethyl-1-[(4-methylphenyl)methyl]benzimidazole (CAS 141211-39-4) is a chemical compound with the molecular formula C17H18N2 and a molecular weight of 250.34 g/mol. IUPAC name: 5,6-dimethyl-1-[(4-methylphenyl)methyl]benzimidazole. InChIKey: PRIOFQYYSHATGH-UHFFFAOYSA-N.
| Molecular formula | C17H18N2 |
|---|---|
| Molecular weight | 250.34 g/mol |
| IUPAC name | 5,6-dimethyl-1-[(4-methylphenyl)methyl]benzimidazole |
| InChIKey | PRIOFQYYSHATGH-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C=NC3=C2C=C(C(=C3)C)C |
Computed by PubChem (NCBI)