cas: 40227-17-6 — see every product listed under this CAS number, including other names
5,6-Dimethylpyrazine-2,3-dicarbonitrile, 98% (CAS 40227-17-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F553204-1G |
| cas | 40227-17-6 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 372.80 Pln | |
| Fluorochem | 5g | 1002.79 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5,6-dimethylpyrazine-2,3-dicarbonitrile (CAS 40227-17-6) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 5,6-dimethylpyrazine-2,3-dicarbonitrile. InChIKey: VPRRXMCIOHZBCX-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 5,6-dimethylpyrazine-2,3-dicarbonitrile |
| InChIKey | VPRRXMCIOHZBCX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C#N)C#N)C |
Computed by PubChem (NCBI)