CAS 40508-03-0 appears in our catalog under these names: 2-(Azidomethyl)benzonitrile, 95%, 2-(Azidomethyl)benzonitrile. Offered by: Combi-blocks, TRC, Biosynth. Available pack sizes: 10g, 5g, 1g, 250mg, 500mg.
2-(azidomethyl)benzonitrile (CAS 40508-03-0) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 2-(azidomethyl)benzonitrile. InChIKey: DTRXXTVEVDAOME-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 2-(azidomethyl)benzonitrile |
| InChIKey | DTRXXTVEVDAOME-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)CN=[N+]=[N-])C#N |
Computed by PubChem (NCBI)