CAS 89939-59-3 appears in our catalog under these names: 5-Amino-1h-indazole-3-carbonitrile, 95%, 5-Amino-2h-indazole-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
5-amino-1H-indazole-3-carbonitrile (CAS 89939-59-3) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 5-amino-1H-indazole-3-carbonitrile. InChIKey: KGEYZMRZVKMQBY-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 5-amino-1H-indazole-3-carbonitrile |
| InChIKey | KGEYZMRZVKMQBY-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1N)C(=NN2)C#N |
Computed by PubChem (NCBI)