CAS 40227-17-6 appears in our catalog under these names: 5,6-Dimethyl-2,3-pyrazinedicarbonitrile, 95%, 5,6-Dimethylpyrazine-2,3-dicarbonitrile, 98%, 98%, 5,6-Dimethylpyrazine-2,3-dicarbonitrile, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 100mg, 250mg.
5,6-dimethylpyrazine-2,3-dicarbonitrile (CAS 40227-17-6) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 5,6-dimethylpyrazine-2,3-dicarbonitrile. InChIKey: VPRRXMCIOHZBCX-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 5,6-dimethylpyrazine-2,3-dicarbonitrile |
| InChIKey | VPRRXMCIOHZBCX-UHFFFAOYSA-N |
| SMILES | CC1=C(N=C(C(=N1)C#N)C#N)C |
Computed by PubChem (NCBI)