CAS 1256795-04-6 is the registry number for 1-Methyl-1h-pyrazolo[3,4-b]pyridine-3-carbonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 1g, 5g.
1-methylpyrazolo[3,4-b]pyridine-3-carbonitrile (CAS 1256795-04-6) is a chemical compound with the molecular formula C8H6N4 and a molecular weight of 158.16 g/mol. IUPAC name: 1-methylpyrazolo[3,4-b]pyridine-3-carbonitrile. InChIKey: QCDPQXVFZVSJJH-UHFFFAOYSA-N.
| Molecular formula | C8H6N4 |
|---|---|
| Molecular weight | 158.16 g/mol |
| IUPAC name | 1-methylpyrazolo[3,4-b]pyridine-3-carbonitrile |
| InChIKey | QCDPQXVFZVSJJH-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C=CC=N2)C(=N1)C#N |
Computed by PubChem (NCBI)