Products 23050-38-6
CAS 23050-38-6 appears in our catalog under these names: 5,7,8–Trimethoxyflavone, 5,7,8-Trimethoxyflavone/ 99.89% (existing batch purity), 5,7,8-Trimethoxyflavone, 5,7,8-Trimethoxyflavone, 99.70%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 1mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 1 mg.
5,7,8-trimethoxy-2-phenylchromen-4-one (CAS 23050-38-6) is a chemical compound with the molecular formula C18H16O5 and a molecular weight of 312.3 g/mol. IUPAC name: 5,7,8-trimethoxy-2-phenylchromen-4-one. InChIKey: VFRLJCKMHUJGFR-UHFFFAOYSA-N.
| Molecular formula | C18H16O5 |
|---|---|
| Molecular weight | 312.3 g/mol |
| IUPAC name | 5,7,8-trimethoxy-2-phenylchromen-4-one |
| InChIKey | VFRLJCKMHUJGFR-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C2=C1C(=O)C=C(O2)C3=CC=CC=C3)OC)OC |
Computed by PubChem (NCBI)