CAS 952435-04-0 appears in our catalog under these names: 5,7-Dichloro-2-methylthieno(3,2-b)pyridine, 95+%, 5,7-Dichloro-2-methylthieno(3,2-b)pyridine, 5,7-Dichloro-2-methylthieno[3,2-b]pyridine, ≥95%, ≥95%, 5,7-Dichloro-2-methylthieno[3,2-b]pyridine, ≥95%. Offered by: AmBeed, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 50mg, 0,5g, 100mg.
5,7-dichloro-2-methylthieno[3,2-b]pyridine (CAS 952435-04-0) is a chemical compound with the molecular formula C8H5Cl2NS and a molecular weight of 218.10 g/mol. IUPAC name: 5,7-dichloro-2-methylthieno[3,2-b]pyridine. InChIKey: YQBGOJOMXKSSMV-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2NS |
|---|---|
| Molecular weight | 218.10 g/mol |
| IUPAC name | 5,7-dichloro-2-methylthieno[3,2-b]pyridine |
| InChIKey | YQBGOJOMXKSSMV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(S1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)