CAS 90363-40-9 appears in our catalog under these names: 5,7–Dimethoxyluteolin, 5,7-Dimethoxyluteolin/ 99.56% (existing batch purity), 5,7-Dimethoxyluteolin, 5,7-Dimethoxyluteolin, 99.47%. Offered by: GLPBio, TargetMol, Biosynth, MedChemExpress. Available pack sizes: 1mg, 5mg, 2mg, 10mg, 100mg, 50mg, 5 mg.
2-(3,4-dihydroxyphenyl)-5,7-dimethoxychromen-4-one (CAS 90363-40-9) is a chemical compound with the molecular formula C17H14O6 and a molecular weight of 314.29 g/mol. IUPAC name: 2-(3,4-dihydroxyphenyl)-5,7-dimethoxychromen-4-one. InChIKey: NKGJZNRUAGQIRY-UHFFFAOYSA-N.
| Molecular formula | C17H14O6 |
|---|---|
| Molecular weight | 314.29 g/mol |
| IUPAC name | 2-(3,4-dihydroxyphenyl)-5,7-dimethoxychromen-4-one |
| InChIKey | NKGJZNRUAGQIRY-UHFFFAOYSA-N |
| SMILES | COC1=CC2=C(C(=C1)OC)C(=O)C=C(O2)C3=CC(=C(C=C3)O)O |
Computed by PubChem (NCBI)