cas: 1059191-52-4 — see every product listed under this CAS number, including other names
5,7-dichloro-2-methyl-Imidazo(1,2-c)pyrimidine, 97% (CAS 1059191-52-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A459020-5g |
| cas | 1059191-52-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 21533.47 Pln | |
| AmBeed | 1g | 17666.53 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
5,7-dichloro-2-methylimidazo[1,2-c]pyrimidine (CAS 1059191-52-4) is a chemical compound with the molecular formula C7H5Cl2N3 and a molecular weight of 202.04 g/mol. IUPAC name: 5,7-dichloro-2-methylimidazo[1,2-c]pyrimidine. InChIKey: XRNTVVRDPNUQET-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3 |
|---|---|
| Molecular weight | 202.04 g/mol |
| IUPAC name | 5,7-dichloro-2-methylimidazo[1,2-c]pyrimidine |
| InChIKey | XRNTVVRDPNUQET-UHFFFAOYSA-N |
| SMILES | CC1=CN2C(=N1)C=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)