cas: 4378-55-6 — see every product listed under this CAS number, including other names
5–(3,4–Dimethoxyphenyl)–5–oxovaleric acid (CAS 4378-55-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD11337-100mg |
| cas | 4378-55-6 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 531.51 Pln | |
| GLPBio | 1g | 915.31 Pln | |
| GLPBio | 250mg | 601.72 Pln | |
| GLPBio | 5g | 1954.38 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid (CAS 4378-55-6) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid. InChIKey: VCPFAIMGNLXMPO-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid |
| InChIKey | VCPFAIMGNLXMPO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCCC(=O)O)OC |
Computed by PubChem (NCBI)