cas: 4378-55-6 — see every product listed under this CAS number, including other names
5-(3,4-Dimethoxyphenyl)-5-oxovaleric acid, 98% (CAS 4378-55-6) is a chemical reagent available from Chemat. Available pack sizes: 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F022999-500MG |
| cas | 4378-55-6 |
| size | 500mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 500mg | 393.63 Pln | |
| Fluorochem | 1g | 487.35 Pln | |
| Fluorochem | 2.5g | 945.52 Pln | |
| Fluorochem | 5g | 1690.05 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid (CAS 4378-55-6) is a chemical compound with the molecular formula C13H16O5 and a molecular weight of 252.26 g/mol. IUPAC name: 5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid. InChIKey: VCPFAIMGNLXMPO-UHFFFAOYSA-N.
| Molecular formula | C13H16O5 |
|---|---|
| Molecular weight | 252.26 g/mol |
| IUPAC name | 5-(3,4-dimethoxyphenyl)-5-oxopentanoic acid |
| InChIKey | VCPFAIMGNLXMPO-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C(=O)CCCC(=O)O)OC |
Computed by PubChem (NCBI)