cas: 67475-56-3 — see every product listed under this CAS number, including other names
5–Fluoro–2–methoxybenzenesulfonyl chloride (CAS 67475-56-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD13531-1g |
| cas | 67475-56-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 615.76 Pln | |
| GLPBio | 25g | 2150.97 Pln | |
| GLPBio | 5g | 1013.60 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-fluoro-2-methoxybenzenesulfonyl chloride (CAS 67475-56-3) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 5-fluoro-2-methoxybenzenesulfonyl chloride. InChIKey: LUEBMKPHZDSPFH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-fluoro-2-methoxybenzenesulfonyl chloride |
| InChIKey | LUEBMKPHZDSPFH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)