cas: 67475-56-3 — see every product listed under this CAS number, including other names
5-Fluoro-2-methoxybenzenesulfonyl chloride, 95% (CAS 67475-56-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F033072-1G |
| cas | 67475-56-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 96.86 Pln | |
| Fluorochem | 5g | 122.89 Pln | |
| Fluorochem | 10g | 164.54 Pln | |
| Fluorochem | 25g | 289.50 Pln | |
| Fluorochem | 100g | 893.45 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
5-fluoro-2-methoxybenzenesulfonyl chloride (CAS 67475-56-3) is a chemical compound with the molecular formula C7H6ClFO3S and a molecular weight of 224.64 g/mol. IUPAC name: 5-fluoro-2-methoxybenzenesulfonyl chloride. InChIKey: LUEBMKPHZDSPFH-UHFFFAOYSA-N.
| Molecular formula | C7H6ClFO3S |
|---|---|
| Molecular weight | 224.64 g/mol |
| IUPAC name | 5-fluoro-2-methoxybenzenesulfonyl chloride |
| InChIKey | LUEBMKPHZDSPFH-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)F)S(=O)(=O)Cl |
Computed by PubChem (NCBI)